C12H10N4O4 — CID 3442927
2,4-dinitro-N-(pyridin-2-ylmethyl)aniline (PubChem CID 3442927) has the molecular formula C12H10N4O4 and a molecular weight of 274.24 g/mol. Its IUPAC name is 2,4-dinitro-N-(pyridin-2-ylmethyl)aniline.
| Compound Name | 2,4-dinitro-N-(pyridin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 3442927 |
| Molecular Formula | C12H10N4O4 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2,4-dinitro-N-(pyridin-2-ylmethyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(NCc2ccccn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N4O4/c17-15(18)10-4-5-11(12(7-10)16(19)20)14-8-9-3-1-2-6-13-9/h1-7,14H,8H2 |
| InChIKey | CEUGRNPNYJVLJQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 111.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|