C12H10N4O6S — CID 71606096
2,4-dinitro-N-(pyridin-2-ylmethyl)benzenesulfonamide (PubChem CID 71606096) has the molecular formula C12H10N4O6S and a molecular weight of 338.30 g/mol. Its IUPAC name is 2,4-dinitro-N-(pyridin-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2,4-dinitro-N-(pyridin-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 71606096 |
| Molecular Formula | C12H10N4O6S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2,4-dinitro-N-(pyridin-2-ylmethyl)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NCc2ccccn2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H10N4O6S/c17-15(18)10-4-5-12(11(7-10)16(19)20)23(21,22)14-8-9-3-1-2-6-13-9/h1-7,14H,8H2 |
| InChIKey | MGCPMINYBKFEMW-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 145.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|