C15H13N5O3 — CID 46265007
4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-nitro-N-(pyridin-2-ylmethyl)aniline (PubChem CID 46265007) has the molecular formula C15H13N5O3 and a molecular weight of 311.30 g/mol. Its IUPAC name is 4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-nitro-N-(pyridin-2-ylmethyl)aniline.
| Compound Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-nitro-N-(pyridin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 46265007 |
| Molecular Formula | C15H13N5O3 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 4-(3-methyl-1,2,4-oxadiazol-5-yl)-2-nitro-N-(pyridin-2-ylmethyl)aniline |
| SMILES | Cc1noc(-c2ccc(NCc3ccccn3)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C15H13N5O3/c1-10-18-15(23-19-10)11-5-6-13(14(8-11)20(21)22)17-9-12-4-2-3-7-16-12/h2-8,17H,9H2,1H3 |
| InChIKey | JJDUWILUVVSANK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|