C15H19N3O4 — CID 71979897
N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methoxy-5-nitroaniline (PubChem CID 71979897) has the molecular formula C15H19N3O4 and a molecular weight of 305.33 g/mol. Its IUPAC name is N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methoxy-5-nitroaniline.
| Compound Name | N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methoxy-5-nitroaniline |
|---|---|
| PubChem CID | 71979897 |
| Molecular Formula | C15H19N3O4 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | N-[(5-tert-butyl-1,3-oxazol-2-yl)methyl]-2-methoxy-5-nitroaniline |
| SMILES | COc1ccc([N+](=O)[O-])cc1NCc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C15H19N3O4/c1-15(2,3)13-8-17-14(22-13)9-16-11-7-10(18(19)20)5-6-12(11)21-4/h5-8,16H,9H2,1-4H3 |
| InChIKey | AGCFDYJLHYOIIF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|