C20H33N5O4S — CID 39008788
4-(azepan-1-ylsulfonyl)-N-[2-(4-ethylpiperazin-1-yl)ethyl]-2-nitroaniline (PubChem CID 39008788) has the molecular formula C20H33N5O4S and a molecular weight of 439.58 g/mol. Its IUPAC name is 4-(azepan-1-ylsulfonyl)-N-[2-(4-ethylpiperazin-1-yl)ethyl]-2-nitroaniline.
| Compound Name | 4-(azepan-1-ylsulfonyl)-N-[2-(4-ethylpiperazin-1-yl)ethyl]-2-nitroaniline |
|---|---|
| PubChem CID | 39008788 |
| Molecular Formula | C20H33N5O4S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 4-(azepan-1-ylsulfonyl)-N-[2-(4-ethylpiperazin-1-yl)ethyl]-2-nitroaniline |
| SMILES | CCN1CCN(CCNc2ccc(S(=O)(=O)N3CCCCCC3)cc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C20H33N5O4S/c1-2-22-13-15-23(16-14-22)12-9-21-19-8-7-18(17-20(19)25(26)27)30(28,29)24-10-5-3-4-6-11-24/h7-8,17,21H,2-6,9-16H2,1H3 |
| InChIKey | GWABPHLXKVNRJU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|