C18H21N3O3S — CID 55890673
N-[5-[4-(cyclopropylmethyl)piperazine-1-carbonyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 55890673) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[5-[4-(cyclopropylmethyl)piperazine-1-carbonyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[4-(cyclopropylmethyl)piperazine-1-carbonyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 55890673 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | N-[5-[4-(cyclopropylmethyl)piperazine-1-carbonyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)N2CCN(CC3CC3)CC2)s1)c1ccco1 |
| InChI | InChI=1S/C18H21N3O3S/c22-17(14-2-1-11-24-14)19-16-6-5-15(25-16)18(23)21-9-7-20(8-10-21)12-13-3-4-13/h1-2,5-6,11,13H,3-4,7-10,12H2,(H,19,22) |
| InChIKey | SQSLASZIWRUBAI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |