C22H20N2O5S — CID 31219375
[4-(pyrrolidine-1-carbonyl)phenyl]methyl 5-(furan-2-carbonylamino)thiophene-2-carboxylate (PubChem CID 31219375) has the molecular formula C22H20N2O5S and a molecular weight of 424.48 g/mol. Its IUPAC name is [4-(pyrrolidine-1-carbonyl)phenyl]methyl 5-(furan-2-carbonylamino)thiophene-2-carboxylate.
| Compound Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl 5-(furan-2-carbonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 31219375 |
| Molecular Formula | C22H20N2O5S |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | [4-(pyrrolidine-1-carbonyl)phenyl]methyl 5-(furan-2-carbonylamino)thiophene-2-carboxylate |
| SMILES | O=C(Nc1ccc(C(=O)OCc2ccc(C(=O)N3CCCC3)cc2)s1)c1ccco1 |
| InChI | InChI=1S/C22H20N2O5S/c25-20(17-4-3-13-28-17)23-19-10-9-18(30-19)22(27)29-14-15-5-7-16(8-6-15)21(26)24-11-1-2-12-24/h3-10,13H,1-2,11-12,14H2,(H,23,25) |
| InChIKey | GRSSMMDLKXAKEB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |