C20H13ClN2O4S — CID 31219418
(2-chloroquinolin-3-yl)methyl 5-(furan-2-carbonylamino)thiophene-2-carboxylate (PubChem CID 31219418) has the molecular formula C20H13ClN2O4S and a molecular weight of 412.85 g/mol. Its IUPAC name is (2-chloroquinolin-3-yl)methyl 5-(furan-2-carbonylamino)thiophene-2-carboxylate.
| Compound Name | (2-chloroquinolin-3-yl)methyl 5-(furan-2-carbonylamino)thiophene-2-carboxylate |
|---|---|
| PubChem CID | 31219418 |
| Molecular Formula | C20H13ClN2O4S |
| Molecular Weight | 412.85 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | (2-chloroquinolin-3-yl)methyl 5-(furan-2-carbonylamino)thiophene-2-carboxylate |
| SMILES | O=C(Nc1ccc(C(=O)OCc2cc3ccccc3nc2Cl)s1)c1ccco1 |
| InChI | InChI=1S/C20H13ClN2O4S/c21-18-13(10-12-4-1-2-5-14(12)22-18)11-27-20(25)16-7-8-17(28-16)23-19(24)15-6-3-9-26-15/h1-10H,11H2,(H,23,24) |
| InChIKey | BSDWKOJGSDGGHV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.85 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|