C18H19F3N2O2S — CID 2210844
1-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]thiourea (PubChem CID 2210844) has the molecular formula C18H19F3N2O2S and a molecular weight of 384.42 g/mol. Its IUPAC name is 1-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2210844 |
| Molecular Formula | C18H19F3N2O2S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]-3-[3-(trifluoromethyl)phenyl]thiourea |
| SMILES | COc1ccc(OC)c([C@@H](C)NC(=S)Nc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C18H19F3N2O2S/c1-11(15-10-14(24-2)7-8-16(15)25-3)22-17(26)23-13-6-4-5-12(9-13)18(19,20)21/h4-11H,1-3H3,(H2,22,23,26)/t11-/m1/s1 |
| InChIKey | RIVQEEFOLKYATR-LLVKDONJSA-N |
| XLogP | 4.77 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|