C17H19BrN2O3 — CID 55696724
1-(3-bromophenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]urea (PubChem CID 55696724) has the molecular formula C17H19BrN2O3 and a molecular weight of 379.25 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-(3-bromophenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 55696724 |
| Molecular Formula | C17H19BrN2O3 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 1-(3-bromophenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)Nc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C17H19BrN2O3/c1-11(15-10-14(22-2)7-8-16(15)23-3)19-17(21)20-13-6-4-5-12(18)9-13/h4-11H,1-3H3,(H2,19,20,21) |
| InChIKey | ZCXURFUEXCODQL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |