C17H18BrClN2O3 — CID 1298550
1-(4-bromo-2-chlorophenyl)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]urea (PubChem CID 1298550) has the molecular formula C17H18BrClN2O3 and a molecular weight of 413.70 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 1298550 |
| Molecular Formula | C17H18BrClN2O3 |
| Molecular Weight | 413.70 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(OC)c([C@H](C)NC(=O)Nc2ccc(Br)cc2Cl)c1 |
| InChI | InChI=1S/C17H18BrClN2O3/c1-10(13-9-12(23-2)5-7-16(13)24-3)20-17(22)21-15-6-4-11(18)8-14(15)19/h4-10H,1-3H3,(H2,20,21,22)/t10-/m0/s1 |
| InChIKey | UEJIEJKMCUWGLU-JTQLQIEISA-N |
| XLogP | 5.00 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.70 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |