C17H18BrNO3 — CID 1323549
3-bromo-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]benzamide (PubChem CID 1323549) has the molecular formula C17H18BrNO3 and a molecular weight of 364.24 g/mol. Its IUPAC name is 3-bromo-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]benzamide.
| Compound Name | 3-bromo-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 1323549 |
| Molecular Formula | C17H18BrNO3 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 3-bromo-N-[(1R)-1-(2,5-dimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1ccc(OC)c([C@@H](C)NC(=O)c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C17H18BrNO3/c1-11(15-10-14(21-2)7-8-16(15)22-3)19-17(20)12-5-4-6-13(18)9-12/h4-11H,1-3H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | BMZUIVUEUHOBLZ-LLVKDONJSA-N |
| XLogP | 3.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |