C22H18Br2N2O3 — CID 2526949
3-bromo-N-[[(3-bromobenzoyl)amino]-(4-methoxyphenyl)methyl]benzamide (PubChem CID 2526949) has the molecular formula C22H18Br2N2O3 and a molecular weight of 518.21 g/mol. Its IUPAC name is 3-bromo-N-[[(3-bromobenzoyl)amino]-(4-methoxyphenyl)methyl]benzamide.
| Compound Name | 3-bromo-N-[[(3-bromobenzoyl)amino]-(4-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 2526949 |
| Molecular Formula | C22H18Br2N2O3 |
| Molecular Weight | 518.21 g/mol |
| Exact Mass | 515.97 |
| IUPAC Name | 3-bromo-N-[[(3-bromobenzoyl)amino]-(4-methoxyphenyl)methyl]benzamide |
| SMILES | COc1ccc(C(NC(=O)c2cccc(Br)c2)NC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C22H18Br2N2O3/c1-29-19-10-8-14(9-11-19)20(25-21(27)15-4-2-6-17(23)12-15)26-22(28)16-5-3-7-18(24)13-16/h2-13,20H,1H3,(H,25,27)(H,26,28) |
| InChIKey | JXBQXMHIMKPWPC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.21 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|