C29H32Br2N2O4 — CID 5209327
3-bromo-N-[[(3-bromobenzoyl)amino]-(4-heptoxy-3-methoxyphenyl)methyl]benzamide (PubChem CID 5209327) has the molecular formula C29H32Br2N2O4 and a molecular weight of 632.39 g/mol. Its IUPAC name is 3-bromo-N-[[(3-bromobenzoyl)amino]-(4-heptoxy-3-methoxyphenyl)methyl]benzamide.
| Compound Name | 3-bromo-N-[[(3-bromobenzoyl)amino]-(4-heptoxy-3-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 5209327 |
| Molecular Formula | C29H32Br2N2O4 |
| Molecular Weight | 632.39 g/mol |
| Exact Mass | 630.07 |
| IUPAC Name | 3-bromo-N-[[(3-bromobenzoyl)amino]-(4-heptoxy-3-methoxyphenyl)methyl]benzamide |
| SMILES | CCCCCCCOc1ccc(C(NC(=O)c2cccc(Br)c2)NC(=O)c2cccc(Br)c2)cc1OC |
| InChI | InChI=1S/C29H32Br2N2O4/c1-3-4-5-6-7-16-37-25-15-14-20(19-26(25)36-2)27(32-28(34)21-10-8-12-23(30)17-21)33-29(35)22-11-9-13-24(31)18-22/h8-15,17-19,27H,3-7,16H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | KSTHVJGFAXKZMI-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.39 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|