C29H32F2N2O4 — CID 18839438
4-fluoro-N-[[(4-fluorobenzoyl)amino]-(4-heptoxy-3-methoxyphenyl)methyl]benzamide (PubChem CID 18839438) has the molecular formula C29H32F2N2O4 and a molecular weight of 510.58 g/mol. Its IUPAC name is 4-fluoro-N-[[(4-fluorobenzoyl)amino]-(4-heptoxy-3-methoxyphenyl)methyl]benzamide.
| Compound Name | 4-fluoro-N-[[(4-fluorobenzoyl)amino]-(4-heptoxy-3-methoxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 18839438 |
| Molecular Formula | C29H32F2N2O4 |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | 4-fluoro-N-[[(4-fluorobenzoyl)amino]-(4-heptoxy-3-methoxyphenyl)methyl]benzamide |
| SMILES | CCCCCCCOc1ccc(C(NC(=O)c2ccc(F)cc2)NC(=O)c2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C29H32F2N2O4/c1-3-4-5-6-7-18-37-25-17-12-22(19-26(25)36-2)27(32-28(34)20-8-13-23(30)14-9-20)33-29(35)21-10-15-24(31)16-11-21/h8-17,19,27H,3-7,18H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | CECJSCSMHRZPIC-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|