C25H30FN3O3 — CID 55452675
N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4-hexoxy-3-methoxybenzamide (PubChem CID 55452675) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4-hexoxy-3-methoxybenzamide.
| Compound Name | N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4-hexoxy-3-methoxybenzamide |
|---|---|
| PubChem CID | 55452675 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | N-[(4-fluorophenyl)-(1-methylimidazol-2-yl)methyl]-4-hexoxy-3-methoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(c2ccc(F)cc2)c2nccn2C)cc1OC |
| InChI | InChI=1S/C25H30FN3O3/c1-4-5-6-7-16-32-21-13-10-19(17-22(21)31-3)25(30)28-23(24-27-14-15-29(24)2)18-8-11-20(26)12-9-18/h8-15,17,23H,4-7,16H2,1-3H3,(H,28,30) |
| InChIKey | LHWQOFVJEGJGGY-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|