C24H40N2O4 — CID 18890129
N-[(3-hexoxy-4-methoxyphenyl)-(pentanoylamino)methyl]pentanamide (PubChem CID 18890129) has the molecular formula C24H40N2O4 and a molecular weight of 420.59 g/mol. Its IUPAC name is N-[(3-hexoxy-4-methoxyphenyl)-(pentanoylamino)methyl]pentanamide.
| Compound Name | N-[(3-hexoxy-4-methoxyphenyl)-(pentanoylamino)methyl]pentanamide |
|---|---|
| PubChem CID | 18890129 |
| Molecular Formula | C24H40N2O4 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | N-[(3-hexoxy-4-methoxyphenyl)-(pentanoylamino)methyl]pentanamide |
| SMILES | CCCCCCOc1cc(C(NC(=O)CCCC)NC(=O)CCCC)ccc1OC |
| InChI | InChI=1S/C24H40N2O4/c1-5-8-11-12-17-30-21-18-19(15-16-20(21)29-4)24(25-22(27)13-9-6-2)26-23(28)14-10-7-3/h15-16,18,24H,5-14,17H2,1-4H3,(H,25,27)(H,26,28) |
| InChIKey | RHUUBPDNCSXICK-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|