C14H20N2O4 — CID 5120159
N-[acetamido-(3-ethoxy-4-methoxyphenyl)methyl]acetamide (PubChem CID 5120159) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is N-[acetamido-(3-ethoxy-4-methoxyphenyl)methyl]acetamide.
| Compound Name | N-[acetamido-(3-ethoxy-4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 5120159 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | N-[acetamido-(3-ethoxy-4-methoxyphenyl)methyl]acetamide |
| SMILES | CCOc1cc(C(NC(C)=O)NC(C)=O)ccc1OC |
| InChI | InChI=1S/C14H20N2O4/c1-5-20-13-8-11(6-7-12(13)19-4)14(15-9(2)17)16-10(3)18/h6-8,14H,5H2,1-4H3,(H,15,17)(H,16,18) |
| InChIKey | ICOYGWNMSWUIBJ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|