C23H30N2O6 — CID 14816122
N-[(1R,3S)-3-acetamido-1,3-bis(3,4-dimethoxyphenyl)propyl]acetamide (PubChem CID 14816122) has the molecular formula C23H30N2O6 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[(1R,3S)-3-acetamido-1,3-bis(3,4-dimethoxyphenyl)propyl]acetamide.
| Compound Name | N-[(1R,3S)-3-acetamido-1,3-bis(3,4-dimethoxyphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 14816122 |
| Molecular Formula | C23H30N2O6 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-[(1R,3S)-3-acetamido-1,3-bis(3,4-dimethoxyphenyl)propyl]acetamide |
| SMILES | COc1ccc([C@H](C[C@@H](NC(C)=O)c2ccc(OC)c(OC)c2)NC(C)=O)cc1OC |
| InChI | InChI=1S/C23H30N2O6/c1-14(26)24-18(16-7-9-20(28-3)22(11-16)30-5)13-19(25-15(2)27)17-8-10-21(29-4)23(12-17)31-6/h7-12,18-19H,13H2,1-6H3,(H,24,26)(H,25,27)/t18-,19+ |
| InChIKey | QVVBBABAUNKNIR-KDURUIRLSA-N |
| XLogP | 3.17 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |