C35H38O5 — CID 141342275
1,3-bis(3-ethoxy-4-methoxyphenyl)-1,3-bis(4-methylphenyl)propan-2-one (PubChem CID 141342275) has the molecular formula C35H38O5 and a molecular weight of 538.68 g/mol. Its IUPAC name is 1,3-bis(3-ethoxy-4-methoxyphenyl)-1,3-bis(4-methylphenyl)propan-2-one.
| Compound Name | 1,3-bis(3-ethoxy-4-methoxyphenyl)-1,3-bis(4-methylphenyl)propan-2-one |
|---|---|
| PubChem CID | 141342275 |
| Molecular Formula | C35H38O5 |
| Molecular Weight | 538.68 g/mol |
| Exact Mass | 538.27 |
| IUPAC Name | 1,3-bis(3-ethoxy-4-methoxyphenyl)-1,3-bis(4-methylphenyl)propan-2-one |
| SMILES | CCOc1cc(C(C(=O)C(c2ccc(C)cc2)c2ccc(OC)c(OCC)c2)c2ccc(C)cc2)ccc1OC |
| InChI | InChI=1S/C35H38O5/c1-7-39-31-21-27(17-19-29(31)37-5)33(25-13-9-23(3)10-14-25)35(36)34(26-15-11-24(4)12-16-26)28-18-20-30(38-6)32(22-28)40-8-2/h9-22,33-34H,7-8H2,1-6H3 |
| InChIKey | RGMOOFOUOCXBBI-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.68 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |