C19H24O3 — CID 82185656
3-(3-ethoxy-4-methoxyphenyl)-1-(4-methylphenyl)propan-1-ol (PubChem CID 82185656) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 3-(3-ethoxy-4-methoxyphenyl)-1-(4-methylphenyl)propan-1-ol.
| Compound Name | 3-(3-ethoxy-4-methoxyphenyl)-1-(4-methylphenyl)propan-1-ol |
|---|---|
| PubChem CID | 82185656 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | 3-(3-ethoxy-4-methoxyphenyl)-1-(4-methylphenyl)propan-1-ol |
| SMILES | CCOc1cc(CCC(O)c2ccc(C)cc2)ccc1OC |
| InChI | InChI=1S/C19H24O3/c1-4-22-19-13-15(8-12-18(19)21-3)7-11-17(20)16-9-5-14(2)6-10-16/h5-6,8-10,12-13,17,20H,4,7,11H2,1-3H3 |
| InChIKey | BBLPJEAHMIEFEH-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |