C16H20O3S — CID 82185525
3-(4-ethoxy-3-methoxyphenyl)-1-thiophen-2-ylpropan-1-ol (PubChem CID 82185525) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is 3-(4-ethoxy-3-methoxyphenyl)-1-thiophen-2-ylpropan-1-ol.
| Compound Name | 3-(4-ethoxy-3-methoxyphenyl)-1-thiophen-2-ylpropan-1-ol |
|---|---|
| PubChem CID | 82185525 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 3-(4-ethoxy-3-methoxyphenyl)-1-thiophen-2-ylpropan-1-ol |
| SMILES | CCOc1ccc(CCC(O)c2cccs2)cc1OC |
| InChI | InChI=1S/C16H20O3S/c1-3-19-14-9-7-12(11-15(14)18-2)6-8-13(17)16-5-4-10-20-16/h4-5,7,9-11,13,17H,3,6,8H2,1-2H3 |
| InChIKey | ABFJYIGQENDYDW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |