C20H27NO3 — CID 119122211
4-[3-[(4-ethoxy-3-methoxyphenyl)methylamino]butyl]phenol (PubChem CID 119122211) has the molecular formula C20H27NO3 and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-[3-[(4-ethoxy-3-methoxyphenyl)methylamino]butyl]phenol.
| Compound Name | 4-[3-[(4-ethoxy-3-methoxyphenyl)methylamino]butyl]phenol |
|---|---|
| PubChem CID | 119122211 |
| Molecular Formula | C20H27NO3 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 4-[3-[(4-ethoxy-3-methoxyphenyl)methylamino]butyl]phenol |
| SMILES | CCOc1ccc(CNC(C)CCc2ccc(O)cc2)cc1OC |
| InChI | InChI=1S/C20H27NO3/c1-4-24-19-12-9-17(13-20(19)23-3)14-21-15(2)5-6-16-7-10-18(22)11-8-16/h7-13,15,21-22H,4-6,14H2,1-3H3 |
| InChIKey | RAHJMCVFIUVGPA-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |