C19H24ClNO3 — CID 119122214
4-[3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]butyl]phenol (PubChem CID 119122214) has the molecular formula C19H24ClNO3 and a molecular weight of 349.86 g/mol. Its IUPAC name is 4-[3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]butyl]phenol.
| Compound Name | 4-[3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]butyl]phenol |
|---|---|
| PubChem CID | 119122214 |
| Molecular Formula | C19H24ClNO3 |
| Molecular Weight | 349.86 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-[3-[(3-chloro-4,5-dimethoxyphenyl)methylamino]butyl]phenol |
| SMILES | COc1cc(CNC(C)CCc2ccc(O)cc2)cc(Cl)c1OC |
| InChI | InChI=1S/C19H24ClNO3/c1-13(4-5-14-6-8-16(22)9-7-14)21-12-15-10-17(20)19(24-3)18(11-15)23-2/h6-11,13,21-22H,4-5,12H2,1-3H3 |
| InChIKey | TUXNUDBXZDVYSU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.86 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |