C19H23ClN2O4 — CID 119122685
2-[2-chloro-4-[[1-(4-hydroxyphenyl)propan-2-ylamino]methyl]-6-methoxyphenoxy]acetamide (PubChem CID 119122685) has the molecular formula C19H23ClN2O4 and a molecular weight of 378.86 g/mol. Its IUPAC name is 2-[2-chloro-4-[[1-(4-hydroxyphenyl)propan-2-ylamino]methyl]-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[2-chloro-4-[[1-(4-hydroxyphenyl)propan-2-ylamino]methyl]-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 119122685 |
| Molecular Formula | C19H23ClN2O4 |
| Molecular Weight | 378.86 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-[2-chloro-4-[[1-(4-hydroxyphenyl)propan-2-ylamino]methyl]-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(CNC(C)Cc2ccc(O)cc2)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C19H23ClN2O4/c1-12(7-13-3-5-15(23)6-4-13)22-10-14-8-16(20)19(17(9-14)25-2)26-11-18(21)24/h3-6,8-9,12,22-23H,7,10-11H2,1-2H3,(H2,21,24) |
| InChIKey | DGPWSEOIGGJEFZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.86 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |