C14H21ClN2O4 — CID 834045
2-[2-chloro-4-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]-6-methoxyphenoxy]acetamide (PubChem CID 834045) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is 2-[2-chloro-4-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]-6-methoxyphenoxy]acetamide.
| Compound Name | 2-[2-chloro-4-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]-6-methoxyphenoxy]acetamide |
|---|---|
| PubChem CID | 834045 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[2-chloro-4-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]-6-methoxyphenoxy]acetamide |
| SMILES | COc1cc(CNC(C)(C)CO)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C14H21ClN2O4/c1-14(2,8-18)17-6-9-4-10(15)13(11(5-9)20-3)21-7-12(16)19/h4-5,17-18H,6-8H2,1-3H3,(H2,16,19) |
| InChIKey | OMBDPWUKEZVKLC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |