C15H23ClN2O4 — CID 964295
2-[2-chloro-6-ethoxy-4-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]phenoxy]acetamide (PubChem CID 964295) has the molecular formula C15H23ClN2O4 and a molecular weight of 330.81 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]phenoxy]acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 964295 |
| Molecular Formula | C15H23ClN2O4 |
| Molecular Weight | 330.81 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-[[(1-hydroxy-2-methylpropan-2-yl)amino]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(CNC(C)(C)CO)cc(Cl)c1OCC(N)=O |
| InChI | InChI=1S/C15H23ClN2O4/c1-4-21-12-6-10(7-18-15(2,3)9-19)5-11(16)14(12)22-8-13(17)20/h5-6,18-19H,4,7-9H2,1-3H3,(H2,17,20) |
| InChIKey | QAWKIPUNHFJSJA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.81 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |