C20H25ClFNO3 — CID 4715486
2-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]-2-methylpropan-1-ol (PubChem CID 4715486) has the molecular formula C20H25ClFNO3 and a molecular weight of 381.88 g/mol. Its IUPAC name is 2-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]-2-methylpropan-1-ol.
| Compound Name | 2-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 4715486 |
| Molecular Formula | C20H25ClFNO3 |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | 2-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methylamino]-2-methylpropan-1-ol |
| SMILES | CCOc1cc(CNC(C)(C)CO)cc(Cl)c1OCc1ccccc1F |
| InChI | InChI=1S/C20H25ClFNO3/c1-4-25-18-10-14(11-23-20(2,3)13-24)9-16(21)19(18)26-12-15-7-5-6-8-17(15)22/h5-10,23-24H,4,11-13H2,1-3H3 |
| InChIKey | GLHDBSGMCGASNB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |