C27H40ClFN2O2 — CID 17214596
N',N'-dibutyl-N-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]propane-1,3-diamine (PubChem CID 17214596) has the molecular formula C27H40ClFN2O2 and a molecular weight of 479.08 g/mol. Its IUPAC name is N',N'-dibutyl-N-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]propane-1,3-diamine.
| Compound Name | N',N'-dibutyl-N-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 17214596 |
| Molecular Formula | C27H40ClFN2O2 |
| Molecular Weight | 479.08 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | N',N'-dibutyl-N-[[3-chloro-5-ethoxy-4-[(2-fluorophenyl)methoxy]phenyl]methyl]propane-1,3-diamine |
| SMILES | CCCCN(CCCC)CCCNCc1cc(Cl)c(OCc2ccccc2F)c(OCC)c1 |
| InChI | InChI=1S/C27H40ClFN2O2/c1-4-7-15-31(16-8-5-2)17-11-14-30-20-22-18-24(28)27(26(19-22)32-6-3)33-21-23-12-9-10-13-25(23)29/h9-10,12-13,18-19,30H,4-8,11,14-17,20-21H2,1-3H3 |
| InChIKey | ZLDNQMMEGWELOW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.08 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|