C19H24ClFN2O2 — CID 4720921
N'-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine (PubChem CID 4720921) has the molecular formula C19H24ClFN2O2 and a molecular weight of 366.86 g/mol. Its IUPAC name is N'-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine.
| Compound Name | N'-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine |
|---|---|
| PubChem CID | 4720921 |
| Molecular Formula | C19H24ClFN2O2 |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N'-[[3-chloro-4-[(2-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-N-methylpropane-1,3-diamine |
| SMILES | CNCCCNCc1cc(Cl)c(OCc2ccccc2F)c(OC)c1 |
| InChI | InChI=1S/C19H24ClFN2O2/c1-22-8-5-9-23-12-14-10-16(20)19(18(11-14)24-2)25-13-15-6-3-4-7-17(15)21/h3-4,6-7,10-11,22-23H,5,8-9,12-13H2,1-2H3 |
| InChIKey | LUVBSITYQFOSCZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|