C14H15BrO2S — CID 61097509
2-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]thiophene (PubChem CID 61097509) has the molecular formula C14H15BrO2S and a molecular weight of 327.24 g/mol. Its IUPAC name is 2-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]thiophene.
| Compound Name | 2-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]thiophene |
|---|---|
| PubChem CID | 61097509 |
| Molecular Formula | C14H15BrO2S |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 326.00 |
| IUPAC Name | 2-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]thiophene |
| SMILES | COc1ccc(CC(Br)c2cccs2)cc1OC |
| InChI | InChI=1S/C14H15BrO2S/c1-16-12-6-5-10(9-13(12)17-2)8-11(15)14-4-3-7-18-14/h3-7,9,11H,8H2,1-2H3 |
| InChIKey | MCDSZIBRXIHSFR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|