C13H14O2S — CID 175110025
2-[(3,4-dimethoxyphenyl)methyl]thiophene (PubChem CID 175110025) has the molecular formula C13H14O2S and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]thiophene.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]thiophene |
|---|---|
| PubChem CID | 175110025 |
| Molecular Formula | C13H14O2S |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]thiophene |
| SMILES | COc1ccc(Cc2cccs2)cc1OC |
| InChI | InChI=1S/C13H14O2S/c1-14-12-6-5-10(9-13(12)15-2)8-11-4-3-7-16-11/h3-7,9H,8H2,1-2H3 |
| InChIKey | QRAOGOSNGKLMRS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |