C15H19NO2 — CID 69220644
azane;4-benzyl-1,2-dimethoxybenzene (PubChem CID 69220644) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is azane;4-benzyl-1,2-dimethoxybenzene.
| Compound Name | azane;4-benzyl-1,2-dimethoxybenzene |
|---|---|
| PubChem CID | 69220644 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | azane;4-benzyl-1,2-dimethoxybenzene |
| SMILES | COc1ccc(Cc2ccccc2)cc1OC.N |
| InChI | InChI=1S/C15H16O2.H3N/c1-16-14-9-8-13(11-15(14)17-2)10-12-6-4-3-5-7-12;/h3-9,11H,10H2,1-2H3;1H3 |
| InChIKey | IGJPZAJZXSFNHR-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 53.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |