C22H21NO3 — CID 135799750
4-benzyl-2-[(3,4-dimethoxyphenyl)iminomethyl]phenol (PubChem CID 135799750) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 4-benzyl-2-[(3,4-dimethoxyphenyl)iminomethyl]phenol.
| Compound Name | 4-benzyl-2-[(3,4-dimethoxyphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 135799750 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 4-benzyl-2-[(3,4-dimethoxyphenyl)iminomethyl]phenol |
| SMILES | COc1ccc(/N=C/c2cc(Cc3ccccc3)ccc2O)cc1OC |
| InChI | InChI=1S/C22H21NO3/c1-25-21-11-9-19(14-22(21)26-2)23-15-18-13-17(8-10-20(18)24)12-16-6-4-3-5-7-16/h3-11,13-15,24H,12H2,1-2H3/b23-15+ |
| InChIKey | HHJAOAFEQALRIS-HZHRSRAPSA-N |
| XLogP | 4.75 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|