C22H21NO2 — CID 135720813
2-[(5-benzyl-2-hydroxyphenyl)methylideneamino]-4,5-dimethylphenol (PubChem CID 135720813) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 2-[(5-benzyl-2-hydroxyphenyl)methylideneamino]-4,5-dimethylphenol.
| Compound Name | 2-[(5-benzyl-2-hydroxyphenyl)methylideneamino]-4,5-dimethylphenol |
|---|---|
| PubChem CID | 135720813 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 2-[(5-benzyl-2-hydroxyphenyl)methylideneamino]-4,5-dimethylphenol |
| SMILES | Cc1cc(O)c(/N=C/c2cc(Cc3ccccc3)ccc2O)cc1C |
| InChI | InChI=1S/C22H21NO2/c1-15-10-20(22(25)11-16(15)2)23-14-19-13-18(8-9-21(19)24)12-17-6-4-3-5-7-17/h3-11,13-14,24-25H,12H2,1-2H3/b23-14+ |
| InChIKey | LVKIXZMJMOBMAA-OEAKJJBVSA-N |
| XLogP | 5.06 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|