C29H24N2O2 — CID 4021463
4-benzyl-2-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol (PubChem CID 4021463) has the molecular formula C29H24N2O2 and a molecular weight of 432.52 g/mol. Its IUPAC name is 4-benzyl-2-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol.
| Compound Name | 4-benzyl-2-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 4021463 |
| Molecular Formula | C29H24N2O2 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | 4-benzyl-2-[[2-methyl-5-(5-methyl-1,3-benzoxazol-2-yl)phenyl]iminomethyl]phenol |
| SMILES | Cc1ccc2oc(-c3ccc(C)c(/N=C/c4cc(Cc5ccccc5)ccc4O)c3)nc2c1 |
| InChI | InChI=1S/C29H24N2O2/c1-19-8-13-28-26(14-19)31-29(33-28)23-11-9-20(2)25(17-23)30-18-24-16-22(10-12-27(24)32)15-21-6-4-3-5-7-21/h3-14,16-18,32H,15H2,1-2H3/b30-18+ |
| InChIKey | UDGKOAXEYSJPQD-UXHLAJHPSA-N |
| XLogP | 7.16 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|