C21H15BrN2O3 — CID 135610237
2-[[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]iminomethyl]-4-bromophenol (PubChem CID 135610237) has the molecular formula C21H15BrN2O3 and a molecular weight of 423.27 g/mol. Its IUPAC name is 2-[[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]iminomethyl]-4-bromophenol.
| Compound Name | 2-[[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]iminomethyl]-4-bromophenol |
|---|---|
| PubChem CID | 135610237 |
| Molecular Formula | C21H15BrN2O3 |
| Molecular Weight | 423.27 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 2-[[5-(1,3-benzoxazol-2-yl)-2-methoxyphenyl]iminomethyl]-4-bromophenol |
| SMILES | COc1ccc(-c2nc3ccccc3o2)cc1/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C21H15BrN2O3/c1-26-19-9-6-13(21-24-16-4-2-3-5-20(16)27-21)11-17(19)23-12-14-10-15(22)7-8-18(14)25/h2-12,25H,1H3/b23-12+ |
| InChIKey | JUFFVRIXWOJIBK-FSJBWODESA-N |
| XLogP | 5.72 |
| TPSA | 67.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.27 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|