C15H10N2O3 — CID 169354003
2-(3-isocyanato-4-methoxyphenyl)-1,3-benzoxazole (PubChem CID 169354003) has the molecular formula C15H10N2O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is 2-(3-isocyanato-4-methoxyphenyl)-1,3-benzoxazole.
| Compound Name | 2-(3-isocyanato-4-methoxyphenyl)-1,3-benzoxazole |
|---|---|
| PubChem CID | 169354003 |
| Molecular Formula | C15H10N2O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | 2-(3-isocyanato-4-methoxyphenyl)-1,3-benzoxazole |
| SMILES | COc1ccc(-c2nc3ccccc3o2)cc1N=C=O |
| InChI | InChI=1S/C15H10N2O3/c1-19-13-7-6-10(8-12(13)16-9-18)15-17-11-4-2-3-5-14(11)20-15/h2-8H,1H3 |
| InChIKey | RPUSMNSRMHENCG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|