C21H13ClI2N2O2 — CID 2840728
2-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]iminomethyl]-4,6-diiodophenol (PubChem CID 2840728) has the molecular formula C21H13ClI2N2O2 and a molecular weight of 614.61 g/mol. Its IUPAC name is 2-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]iminomethyl]-4,6-diiodophenol.
| Compound Name | 2-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]iminomethyl]-4,6-diiodophenol |
|---|---|
| PubChem CID | 2840728 |
| Molecular Formula | C21H13ClI2N2O2 |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 613.88 |
| IUPAC Name | 2-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]iminomethyl]-4,6-diiodophenol |
| SMILES | Cc1ccc(-c2nc3cc(Cl)ccc3o2)cc1/N=C/c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C21H13ClI2N2O2/c1-11-2-3-12(21-26-18-8-14(22)4-5-19(18)28-21)7-17(11)25-10-13-6-15(23)9-16(24)20(13)27/h2-10,27H,1H3/b25-10+ |
| InChIKey | YPVBQJFXFAEXGB-KIBLKLHPSA-N |
| XLogP | 7.12 |
| TPSA | 58.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|