C28H20ClN3O4 — CID 4015317
4-benzyl-2-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]iminomethyl]-6-nitrophenol (PubChem CID 4015317) has the molecular formula C28H20ClN3O4 and a molecular weight of 497.94 g/mol. Its IUPAC name is 4-benzyl-2-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]iminomethyl]-6-nitrophenol.
| Compound Name | 4-benzyl-2-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 4015317 |
| Molecular Formula | C28H20ClN3O4 |
| Molecular Weight | 497.94 g/mol |
| Exact Mass | 497.11 |
| IUPAC Name | 4-benzyl-2-[[5-(5-chloro-1,3-benzoxazol-2-yl)-2-methylphenyl]iminomethyl]-6-nitrophenol |
| SMILES | Cc1ccc(-c2nc3cc(Cl)ccc3o2)cc1/N=C/c1cc(Cc2ccccc2)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C28H20ClN3O4/c1-17-7-8-20(28-31-24-15-22(29)9-10-26(24)36-28)14-23(17)30-16-21-12-19(11-18-5-3-2-4-6-18)13-25(27(21)33)32(34)35/h2-10,12-16,33H,11H2,1H3/b30-16+ |
| InChIKey | JYAFRWWUHNBUGW-OKCVXOCRSA-N |
| XLogP | 7.41 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.94 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|