C21H18N2O4 — CID 3923756
4-benzyl-2-[(2-hydroxy-5-methylphenyl)iminomethyl]-6-nitrophenol (PubChem CID 3923756) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 4-benzyl-2-[(2-hydroxy-5-methylphenyl)iminomethyl]-6-nitrophenol.
| Compound Name | 4-benzyl-2-[(2-hydroxy-5-methylphenyl)iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 3923756 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 4-benzyl-2-[(2-hydroxy-5-methylphenyl)iminomethyl]-6-nitrophenol |
| SMILES | Cc1ccc(O)c(/N=C/c2cc(Cc3ccccc3)cc([N+](=O)[O-])c2O)c1 |
| InChI | InChI=1S/C21H18N2O4/c1-14-7-8-20(24)18(9-14)22-13-17-11-16(10-15-5-3-2-4-6-15)12-19(21(17)25)23(26)27/h2-9,11-13,24-25H,10H2,1H3/b22-13+ |
| InChIKey | JVGYVWIHLXCCDF-LPYMAVHISA-N |
| XLogP | 4.66 |
| TPSA | 95.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_phenol_A(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|