C22H21N3O3 — CID 3587878
4-benzyl-2-[[4-(dimethylamino)phenyl]iminomethyl]-6-nitrophenol (PubChem CID 3587878) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 4-benzyl-2-[[4-(dimethylamino)phenyl]iminomethyl]-6-nitrophenol.
| Compound Name | 4-benzyl-2-[[4-(dimethylamino)phenyl]iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 3587878 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-benzyl-2-[[4-(dimethylamino)phenyl]iminomethyl]-6-nitrophenol |
| SMILES | CN(C)c1ccc(/N=C/c2cc(Cc3ccccc3)cc([N+](=O)[O-])c2O)cc1 |
| InChI | InChI=1S/C22H21N3O3/c1-24(2)20-10-8-19(9-11-20)23-15-18-13-17(12-16-6-4-3-5-7-16)14-21(22(18)26)25(27)28/h3-11,13-15,26H,12H2,1-2H3/b23-15+ |
| InChIKey | BUBWEFNVPUZQNK-HZHRSRAPSA-N |
| XLogP | 4.71 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|