C17H18ClN3O4 — CID 135774266
4-chloro-2-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]iminomethyl]-6-nitrophenol (PubChem CID 135774266) has the molecular formula C17H18ClN3O4 and a molecular weight of 363.80 g/mol. Its IUPAC name is 4-chloro-2-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]iminomethyl]-6-nitrophenol.
| Compound Name | 4-chloro-2-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135774266 |
| Molecular Formula | C17H18ClN3O4 |
| Molecular Weight | 363.80 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 4-chloro-2-[[4-[ethyl(2-hydroxyethyl)amino]phenyl]iminomethyl]-6-nitrophenol |
| SMILES | CCN(CCO)c1ccc(/N=C/c2cc(Cl)cc([N+](=O)[O-])c2O)cc1 |
| InChI | InChI=1S/C17H18ClN3O4/c1-2-20(7-8-22)15-5-3-14(4-6-15)19-11-12-9-13(18)10-16(17(12)23)21(24)25/h3-6,9-11,22-23H,2,7-8H2,1H3/b19-11+ |
| InChIKey | XFRDYVOSNJRSFY-YBFXNURJSA-N |
| XLogP | 3.52 |
| TPSA | 99.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.80 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|