C27H17Cl2N3O4 — CID 4019500
4-benzyl-2-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-nitrophenol (PubChem CID 4019500) has the molecular formula C27H17Cl2N3O4 and a molecular weight of 518.36 g/mol. Its IUPAC name is 4-benzyl-2-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-nitrophenol.
| Compound Name | 4-benzyl-2-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-nitrophenol |
|---|---|
| PubChem CID | 4019500 |
| Molecular Formula | C27H17Cl2N3O4 |
| Molecular Weight | 518.36 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | 4-benzyl-2-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(Cc2ccccc2)cc(/C=N/c2ccc3oc(-c4ccc(Cl)cc4Cl)nc3c2)c1O |
| InChI | InChI=1S/C27H17Cl2N3O4/c28-19-6-8-21(22(29)13-19)27-31-23-14-20(7-9-25(23)36-27)30-15-18-11-17(10-16-4-2-1-3-5-16)12-24(26(18)33)32(34)35/h1-9,11-15,33H,10H2/b30-15+ |
| InChIKey | HAJVWONICDXKOT-FJEPWZHXSA-N |
| XLogP | 7.76 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.36 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|