C20H10Cl3N3O3 — CID 3998271
1-(4-chloro-3-nitrophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine (PubChem CID 3998271) has the molecular formula C20H10Cl3N3O3 and a molecular weight of 446.68 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine.
| Compound Name | 1-(4-chloro-3-nitrophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 3998271 |
| Molecular Formula | C20H10Cl3N3O3 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine |
| SMILES | O=[N+]([O-])c1cc(/C=N/c2ccc3oc(-c4ccc(Cl)cc4Cl)nc3c2)ccc1Cl |
| InChI | InChI=1S/C20H10Cl3N3O3/c21-12-2-4-14(16(23)8-12)20-25-17-9-13(3-6-19(17)29-20)24-10-11-1-5-15(22)18(7-11)26(27)28/h1-10H/b24-10+ |
| InChIKey | RRYSWENITSUWEL-YSURURNPSA-N |
| XLogP | 7.11 |
| TPSA | 81.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|