C13H7Cl3N2O2 — CID 757863
1-(4-chloro-3-nitrophenyl)-N-(3,4-dichlorophenyl)methanimine (PubChem CID 757863) has the molecular formula C13H7Cl3N2O2 and a molecular weight of 329.57 g/mol. Its IUPAC name is 1-(4-chloro-3-nitrophenyl)-N-(3,4-dichlorophenyl)methanimine.
| Compound Name | 1-(4-chloro-3-nitrophenyl)-N-(3,4-dichlorophenyl)methanimine |
|---|---|
| PubChem CID | 757863 |
| Molecular Formula | C13H7Cl3N2O2 |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 327.96 |
| IUPAC Name | 1-(4-chloro-3-nitrophenyl)-N-(3,4-dichlorophenyl)methanimine |
| SMILES | O=[N+]([O-])c1cc(/C=N/c2ccc(Cl)c(Cl)c2)ccc1Cl |
| InChI | InChI=1S/C13H7Cl3N2O2/c14-10-4-2-9(6-12(10)16)17-7-8-1-3-11(15)13(5-8)18(19)20/h1-7H/b17-7+ |
| InChIKey | ACFGLOAUQYKITF-REZTVBANSA-N |
| XLogP | 5.31 |
| TPSA | 55.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|