C14H8Cl3NO2 — CID 125465323
1-chloro-4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-nitrobenzene (PubChem CID 125465323) has the molecular formula C14H8Cl3NO2 and a molecular weight of 328.58 g/mol. Its IUPAC name is 1-chloro-4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-nitrobenzene.
| Compound Name | 1-chloro-4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-nitrobenzene |
|---|---|
| PubChem CID | 125465323 |
| Molecular Formula | C14H8Cl3NO2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | 1-chloro-4-[(E)-2-(3,4-dichlorophenyl)ethenyl]-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1cc(/C=C/c2ccc(Cl)c(Cl)c2)ccc1Cl |
| InChI | InChI=1S/C14H8Cl3NO2/c15-11-5-3-9(7-13(11)17)1-2-10-4-6-12(16)14(8-10)18(19)20/h1-8H/b2-1+ |
| InChIKey | ROEUWRCBXNUQSX-OWOJBTEDSA-N |
| XLogP | 5.73 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|