C28H16Cl2N2O — CID 171978521
1-anthracen-9-yl-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine (PubChem CID 171978521) has the molecular formula C28H16Cl2N2O and a molecular weight of 467.36 g/mol. Its IUPAC name is 1-anthracen-9-yl-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine.
| Compound Name | 1-anthracen-9-yl-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine |
|---|---|
| PubChem CID | 171978521 |
| Molecular Formula | C28H16Cl2N2O |
| Molecular Weight | 467.36 g/mol |
| Exact Mass | 466.06 |
| IUPAC Name | 1-anthracen-9-yl-N-[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]methanimine |
| SMILES | Clc1ccc(-c2nc3cc(/N=C/c4c5ccccc5cc5ccccc45)ccc3o2)c(Cl)c1 |
| InChI | InChI=1S/C28H16Cl2N2O/c29-19-9-11-23(25(30)14-19)28-32-26-15-20(10-12-27(26)33-28)31-16-24-21-7-3-1-5-17(21)13-18-6-2-4-8-22(18)24/h1-16H/b31-16+ |
| InChIKey | GDFXMHZMHQNBOZ-WCMJOSRZSA-N |
| XLogP | 8.86 |
| TPSA | 38.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.36 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|