C27H15BrCl2N2O3 — CID 3427857
[4-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenyl] 4-bromobenzoate (PubChem CID 3427857) has the molecular formula C27H15BrCl2N2O3 and a molecular weight of 566.24 g/mol. Its IUPAC name is [4-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 3427857 |
| Molecular Formula | C27H15BrCl2N2O3 |
| Molecular Weight | 566.24 g/mol |
| Exact Mass | 563.96 |
| IUPAC Name | [4-[[2-(2,4-dichlorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenyl] 4-bromobenzoate |
| SMILES | O=C(Oc1ccc(/C=N/c2ccc3oc(-c4ccc(Cl)cc4Cl)nc3c2)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H15BrCl2N2O3/c28-18-5-3-17(4-6-18)27(33)34-21-9-1-16(2-10-21)15-31-20-8-12-25-24(14-20)32-26(35-25)22-11-7-19(29)13-23(22)30/h1-15H/b31-15+ |
| InChIKey | BBTQLVRPIBMFMV-IBBHUPRXSA-N |
| XLogP | 8.53 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.24 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|