C27H16BrFN2O3 — CID 5075213
[4-[[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenyl] 4-bromobenzoate (PubChem CID 5075213) has the molecular formula C27H16BrFN2O3 and a molecular weight of 515.34 g/mol. Its IUPAC name is [4-[[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenyl] 4-bromobenzoate.
| Compound Name | [4-[[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenyl] 4-bromobenzoate |
|---|---|
| PubChem CID | 5075213 |
| Molecular Formula | C27H16BrFN2O3 |
| Molecular Weight | 515.34 g/mol |
| Exact Mass | 514.03 |
| IUPAC Name | [4-[[2-(3-fluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]phenyl] 4-bromobenzoate |
| SMILES | O=C(Oc1ccc(/C=N/c2ccc3oc(-c4cccc(F)c4)nc3c2)cc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C27H16BrFN2O3/c28-20-8-6-18(7-9-20)27(32)33-23-11-4-17(5-12-23)16-30-22-10-13-25-24(15-22)31-26(34-25)19-2-1-3-21(29)14-19/h1-16H/b30-16+ |
| InChIKey | PNMXJBRXKJZEDD-OKCVXOCRSA-N |
| XLogP | 7.37 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.34 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|